C22H30ClN2O5PS — CID 71816681
N-(4-chlorophenyl)-4-diethoxyphosphoryl-1-(4-methylphenyl)sulfonylpiperidin-4-amine (PubChem CID 71816681) has the molecular formula C22H30ClN2O5PS and a molecular weight of 500.99 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-diethoxyphosphoryl-1-(4-methylphenyl)sulfonylpiperidin-4-amine.
| Compound Name | N-(4-chlorophenyl)-4-diethoxyphosphoryl-1-(4-methylphenyl)sulfonylpiperidin-4-amine |
|---|---|
| PubChem CID | 71816681 |
| Molecular Formula | C22H30ClN2O5PS |
| Molecular Weight | 500.99 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | N-(4-chlorophenyl)-4-diethoxyphosphoryl-1-(4-methylphenyl)sulfonylpiperidin-4-amine |
| SMILES | CCOP(=O)(OCC)C1(Nc2ccc(Cl)cc2)CCN(S(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C22H30ClN2O5PS/c1-4-29-31(26,30-5-2)22(24-20-10-8-19(23)9-11-20)14-16-25(17-15-22)32(27,28)21-12-6-18(3)7-13-21/h6-13,24H,4-5,14-17H2,1-3H3 |
| InChIKey | GBEQFSNEKKHZLZ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.99 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|