C19H30NO6PS — CID 11293362
(3aR,6aR)-3a-diethoxyphosphoryl-3,3-dimethyl-5-(4-methylphenyl)sulfonyl-1,4,6,6a-tetrahydrofuro[3,4-c]pyrrole (PubChem CID 11293362) has the molecular formula C19H30NO6PS and a molecular weight of 431.49 g/mol. Its IUPAC name is (3aR,6aR)-3a-diethoxyphosphoryl-3,3-dimethyl-5-(4-methylphenyl)sulfonyl-1,4,6,6a-tetrahydrofuro[3,4-c]pyrrole.
| Compound Name | (3aR,6aR)-3a-diethoxyphosphoryl-3,3-dimethyl-5-(4-methylphenyl)sulfonyl-1,4,6,6a-tetrahydrofuro[3,4-c]pyrrole |
|---|---|
| PubChem CID | 11293362 |
| Molecular Formula | C19H30NO6PS |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | (3aR,6aR)-3a-diethoxyphosphoryl-3,3-dimethyl-5-(4-methylphenyl)sulfonyl-1,4,6,6a-tetrahydrofuro[3,4-c]pyrrole |
| SMILES | CCOP(=O)(OCC)[C@@]12CN(S(=O)(=O)c3ccc(C)cc3)C[C@@H]1COC2(C)C |
| InChI | InChI=1S/C19H30NO6PS/c1-6-25-27(21,26-7-2)19-14-20(12-16(19)13-24-18(19,4)5)28(22,23)17-10-8-15(3)9-11-17/h8-11,16H,6-7,12-14H2,1-5H3/t16-,19+/m1/s1 |
| InChIKey | DYZHAGJREVYRPU-APWZRJJASA-N |
| XLogP | 3.43 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|