C28H33FO3 — CID 71817063
[(3S,8R,9S,10R,13S,14S)-17-(4-fluorophenyl)-16-formyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 71817063) has the molecular formula C28H33FO3 and a molecular weight of 436.57 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S)-17-(4-fluorophenyl)-16-formyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,8R,9S,10R,13S,14S)-17-(4-fluorophenyl)-16-formyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 71817063 |
| Molecular Formula | C28H33FO3 |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S)-17-(4-fluorophenyl)-16-formyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@]2(C)C(c4ccc(F)cc4)=C(C=O)C[C@@H]32)C1 |
| InChI | InChI=1S/C28H33FO3/c1-17(31)32-22-10-12-27(2)20(15-22)6-9-23-24(27)11-13-28(3)25(23)14-19(16-30)26(28)18-4-7-21(29)8-5-18/h4-8,16,22-25H,9-15H2,1-3H3/t22-,23+,24-,25-,27-,28-/m0/s1 |
| InChIKey | PJLZMSRMQWFVOI-HCQMQIOBSA-N |
| XLogP | 6.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|