C30H33FN2O3 — CID 72707470
[(3S,8R,9S,10R,13S,14S)-16-formyl-10,13-dimethyl-17-pyrazol-1-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-fluorobenzoate (PubChem CID 72707470) has the molecular formula C30H33FN2O3 and a molecular weight of 488.60 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S)-16-formyl-10,13-dimethyl-17-pyrazol-1-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-fluorobenzoate.
| Compound Name | [(3S,8R,9S,10R,13S,14S)-16-formyl-10,13-dimethyl-17-pyrazol-1-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 72707470 |
| Molecular Formula | C30H33FN2O3 |
| Molecular Weight | 488.60 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S)-16-formyl-10,13-dimethyl-17-pyrazol-1-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-fluorobenzoate |
| SMILES | C[C@]12CC[C@H](OC(=O)c3ccc(F)cc3)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(n3cccn3)=C(C=O)C[C@@H]12 |
| InChI | InChI=1S/C30H33FN2O3/c1-29-12-10-23(36-28(35)19-4-7-22(31)8-5-19)17-21(29)6-9-24-25(29)11-13-30(2)26(24)16-20(18-34)27(30)33-15-3-14-32-33/h3-8,14-15,18,23-26H,9-13,16-17H2,1-2H3/t23-,24+,25-,26-,29-,30-/m0/s1 |
| InChIKey | ASNSVMQMWUEOST-HURDLCFYSA-N |
| XLogP | 6.23 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.60 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|