C32H35N3O4 — CID 91827672
[(3S,8R,9S,10R,13S,14S)-16-formyl-10,13-dimethyl-17-(1,2,4-triazol-1-yl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-(4-formylphenyl)prop-2-enoate (PubChem CID 91827672) has the molecular formula C32H35N3O4 and a molecular weight of 525.65 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S)-16-formyl-10,13-dimethyl-17-(1,2,4-triazol-1-yl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-(4-formylphenyl)prop-2-enoate.
| Compound Name | [(3S,8R,9S,10R,13S,14S)-16-formyl-10,13-dimethyl-17-(1,2,4-triazol-1-yl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-(4-formylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 91827672 |
| Molecular Formula | C32H35N3O4 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S)-16-formyl-10,13-dimethyl-17-(1,2,4-triazol-1-yl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-(4-formylphenyl)prop-2-enoate |
| SMILES | C[C@]12CC[C@H](OC(=O)/C=C/c3ccc(C=O)cc3)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(n3cncn3)=C(C=O)C[C@@H]12 |
| InChI | InChI=1S/C32H35N3O4/c1-31-13-11-25(39-29(38)10-7-21-3-5-22(17-36)6-4-21)16-24(31)8-9-26-27(31)12-14-32(2)28(26)15-23(18-37)30(32)35-20-33-19-34-35/h3-8,10,17-20,25-28H,9,11-16H2,1-2H3/b10-7+/t25-,26+,27-,28-,31-,32-/m0/s1 |
| InChIKey | PHGGXUHLNTZDCX-FGODKBISSA-N |
| XLogP | 5.70 |
| TPSA | 91.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|