C30H32F3N3O3 — CID 72707605
[(3S,8R,9S,10R,13S,14S)-16-formyl-10,13-dimethyl-17-(1,2,4-triazol-1-yl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-(trifluoromethyl)benzoate (PubChem CID 72707605) has the molecular formula C30H32F3N3O3 and a molecular weight of 539.60 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S)-16-formyl-10,13-dimethyl-17-(1,2,4-triazol-1-yl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-(trifluoromethyl)benzoate.
| Compound Name | [(3S,8R,9S,10R,13S,14S)-16-formyl-10,13-dimethyl-17-(1,2,4-triazol-1-yl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 72707605 |
| Molecular Formula | C30H32F3N3O3 |
| Molecular Weight | 539.60 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S)-16-formyl-10,13-dimethyl-17-(1,2,4-triazol-1-yl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-(trifluoromethyl)benzoate |
| SMILES | C[C@]12CC[C@H](OC(=O)c3ccc(C(F)(F)F)cc3)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(n3cncn3)=C(C=O)C[C@@H]12 |
| InChI | InChI=1S/C30H32F3N3O3/c1-28-11-9-22(39-27(38)18-3-5-20(6-4-18)30(31,32)33)14-21(28)7-8-23-24(28)10-12-29(2)25(23)13-19(15-37)26(29)36-17-34-16-35-36/h3-7,15-17,22-25H,8-14H2,1-2H3/t22-,23+,24-,25-,28-,29-/m0/s1 |
| InChIKey | SDYOOZBHKYUABL-UMALJDHNSA-N |
| XLogP | 6.51 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.60 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|