C26H33NO4 — CID 91345915
[(10R,13S)-10,13-dimethyl-17-nitroso-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-hydroxybenzoate (PubChem CID 91345915) has the molecular formula C26H33NO4 and a molecular weight of 423.55 g/mol. Its IUPAC name is [(10R,13S)-10,13-dimethyl-17-nitroso-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-hydroxybenzoate.
| Compound Name | [(10R,13S)-10,13-dimethyl-17-nitroso-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-hydroxybenzoate |
|---|---|
| PubChem CID | 91345915 |
| Molecular Formula | C26H33NO4 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | [(10R,13S)-10,13-dimethyl-17-nitroso-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-hydroxybenzoate |
| SMILES | C[C@]12CCC3C(CC=C4CC(OC(=O)c5ccc(O)cc5)CC[C@@]43C)C1CCC2N=O |
| InChI | InChI=1S/C26H33NO4/c1-25-13-11-19(31-24(29)16-3-6-18(28)7-4-16)15-17(25)5-8-20-21-9-10-23(27-30)26(21,2)14-12-22(20)25/h3-7,19-23,28H,8-15H2,1-2H3/t19?,20?,21?,22?,23?,25-,26-/m0/s1 |
| InChIKey | BGBVURUJIHLHBI-MTDHOPOQSA-N |
| XLogP | 6.02 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|