C27H27N3O5 — CID 71818034
(3R,4R,5S)-3-(azidomethyl)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-one (PubChem CID 71818034) has the molecular formula C27H27N3O5 and a molecular weight of 473.53 g/mol. Its IUPAC name is (3R,4R,5S)-3-(azidomethyl)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-one.
| Compound Name | (3R,4R,5S)-3-(azidomethyl)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-one |
|---|---|
| PubChem CID | 71818034 |
| Molecular Formula | C27H27N3O5 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | (3R,4R,5S)-3-(azidomethyl)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-one |
| SMILES | [N-]=[N+]=NC[C@]1(OCc2ccccc2)C(=O)O[C@@H](COCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C27H27N3O5/c28-30-29-20-27(34-18-23-14-8-3-9-15-23)25(33-17-22-12-6-2-7-13-22)24(35-26(27)31)19-32-16-21-10-4-1-5-11-21/h1-15,24-25H,16-20H2/t24-,25+,27+/m0/s1 |
| InChIKey | UZCPBDXRPZHEJK-ZWEKWIFMSA-N |
| XLogP | 4.98 |
| TPSA | 102.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|