C24H31N7O3 — CID 71818122
(2S)-4-(5-aminopentyl)-N-[2-(1H-imidazol-5-yl)ethyl]-2-(1H-indol-3-ylmethyl)-3,6-dioxopiperazine-1-carboxamide (PubChem CID 71818122) has the molecular formula C24H31N7O3 and a molecular weight of 465.56 g/mol. Its IUPAC name is (2S)-4-(5-aminopentyl)-N-[2-(1H-imidazol-5-yl)ethyl]-2-(1H-indol-3-ylmethyl)-3,6-dioxopiperazine-1-carboxamide.
| Compound Name | (2S)-4-(5-aminopentyl)-N-[2-(1H-imidazol-5-yl)ethyl]-2-(1H-indol-3-ylmethyl)-3,6-dioxopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 71818122 |
| Molecular Formula | C24H31N7O3 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | (2S)-4-(5-aminopentyl)-N-[2-(1H-imidazol-5-yl)ethyl]-2-(1H-indol-3-ylmethyl)-3,6-dioxopiperazine-1-carboxamide |
| SMILES | NCCCCCN1CC(=O)N(C(=O)NCCc2cnc[nH]2)[C@@H](Cc2c[nH]c3ccccc23)C1=O |
| InChI | InChI=1S/C24H31N7O3/c25-9-4-1-5-11-30-15-22(32)31(24(34)27-10-8-18-14-26-16-29-18)21(23(30)33)12-17-13-28-20-7-3-2-6-19(17)20/h2-3,6-7,13-14,16,21,28H,1,4-5,8-12,15,25H2,(H,26,29)(H,27,34)/t21-/m0/s1 |
| InChIKey | BHBDSHDCDALCPM-NRFANRHFSA-N |
| XLogP | 1.55 |
| TPSA | 140.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|