C20H24FN3O4 — CID 71824056
ethyl 4-[(6-fluoro-4-methoxy-8-methylquinoline-2-carbonyl)amino]piperidine-1-carboxylate (PubChem CID 71824056) has the molecular formula C20H24FN3O4 and a molecular weight of 389.43 g/mol. Its IUPAC name is ethyl 4-[(6-fluoro-4-methoxy-8-methylquinoline-2-carbonyl)amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(6-fluoro-4-methoxy-8-methylquinoline-2-carbonyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71824056 |
| Molecular Formula | C20H24FN3O4 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | ethyl 4-[(6-fluoro-4-methoxy-8-methylquinoline-2-carbonyl)amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)c2cc(OC)c3cc(F)cc(C)c3n2)CC1 |
| InChI | InChI=1S/C20H24FN3O4/c1-4-28-20(26)24-7-5-14(6-8-24)22-19(25)16-11-17(27-3)15-10-13(21)9-12(2)18(15)23-16/h9-11,14H,4-8H2,1-3H3,(H,22,25) |
| InChIKey | JAKOBXRYJMLKMJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |