C29H26N4O4 — CID 71825727
N-[(3,4-dimethoxyphenyl)methyl]-2-(14-oxo-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4,6,8,15,17,19-octaen-3-yl)acetamide (PubChem CID 71825727) has the molecular formula C29H26N4O4 and a molecular weight of 494.55 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-2-(14-oxo-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4,6,8,15,17,19-octaen-3-yl)acetamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-2-(14-oxo-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4,6,8,15,17,19-octaen-3-yl)acetamide |
|---|---|
| PubChem CID | 71825727 |
| Molecular Formula | C29H26N4O4 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-2-(14-oxo-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4,6,8,15,17,19-octaen-3-yl)acetamide |
| SMILES | COc1ccc(CNC(=O)Cn2c3c(c4ccccc42)CCn2c-3nc3ccccc3c2=O)cc1OC |
| InChI | InChI=1S/C29H26N4O4/c1-36-24-12-11-18(15-25(24)37-2)16-30-26(34)17-33-23-10-6-4-7-19(23)20-13-14-32-28(27(20)33)31-22-9-5-3-8-21(22)29(32)35/h3-12,15H,13-14,16-17H2,1-2H3,(H,30,34) |
| InChIKey | WENOPEQHWPXQJZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|