C31H29N5O3 — CID 71826222
3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4,6,8,15,17,19-octaen-14-one (PubChem CID 71826222) has the molecular formula C31H29N5O3 and a molecular weight of 519.61 g/mol. Its IUPAC name is 3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4,6,8,15,17,19-octaen-14-one.
| Compound Name | 3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4,6,8,15,17,19-octaen-14-one |
|---|---|
| PubChem CID | 71826222 |
| Molecular Formula | C31H29N5O3 |
| Molecular Weight | 519.61 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | 3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4,6,8,15,17,19-octaen-14-one |
| SMILES | COc1ccc(N2CCN(C(=O)Cn3c4c(c5ccccc53)CCn3c-4nc4ccccc4c3=O)CC2)cc1 |
| InChI | InChI=1S/C31H29N5O3/c1-39-22-12-10-21(11-13-22)33-16-18-34(19-17-33)28(37)20-36-27-9-5-3-6-23(27)24-14-15-35-30(29(24)36)32-26-8-4-2-7-25(26)31(35)38/h2-13H,14-20H2,1H3 |
| InChIKey | WRMGCMCACMDTQA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 72.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.61 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|