C17H20F3N5O3 — CID 71828792
ethyl 1,3,5-trimethyl-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]pyrrole-2-carboxylate (PubChem CID 71828792) has the molecular formula C17H20F3N5O3 and a molecular weight of 399.37 g/mol. Its IUPAC name is ethyl 1,3,5-trimethyl-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]pyrrole-2-carboxylate.
| Compound Name | ethyl 1,3,5-trimethyl-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 71828792 |
| Molecular Formula | C17H20F3N5O3 |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | ethyl 1,3,5-trimethyl-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1c(C)c(C(=O)N2CCn3c(nnc3C(F)(F)F)C2)c(C)n1C |
| InChI | InChI=1S/C17H20F3N5O3/c1-5-28-15(27)13-9(2)12(10(3)23(13)4)14(26)24-6-7-25-11(8-24)21-22-16(25)17(18,19)20/h5-8H2,1-4H3 |
| InChIKey | NRSRHTHRCFYGRZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 82.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |