C20H20N6O2 — CID 71829507
(2S)-N-[2-(4-methoxyindol-1-yl)ethyl]-2-phenyl-2-(tetrazol-1-yl)acetamide (PubChem CID 71829507) has the molecular formula C20H20N6O2 and a molecular weight of 376.42 g/mol. Its IUPAC name is (2S)-N-[2-(4-methoxyindol-1-yl)ethyl]-2-phenyl-2-(tetrazol-1-yl)acetamide.
| Compound Name | (2S)-N-[2-(4-methoxyindol-1-yl)ethyl]-2-phenyl-2-(tetrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 71829507 |
| Molecular Formula | C20H20N6O2 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | (2S)-N-[2-(4-methoxyindol-1-yl)ethyl]-2-phenyl-2-(tetrazol-1-yl)acetamide |
| SMILES | COc1cccc2c1ccn2CCNC(=O)[C@H](c1ccccc1)n1cnnn1 |
| InChI | InChI=1S/C20H20N6O2/c1-28-18-9-5-8-17-16(18)10-12-25(17)13-11-21-20(27)19(26-14-22-23-24-26)15-6-3-2-4-7-15/h2-10,12,14,19H,11,13H2,1H3,(H,21,27)/t19-/m0/s1 |
| InChIKey | HOPDQMDVSIGVLU-IBGZPJMESA-N |
| XLogP | 2.04 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |