C25H20F3N3O2S — CID 71830947
N-[(2,4-dimethoxyphenyl)methylideneamino]-4-phenyl-3-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-imine (PubChem CID 71830947) has the molecular formula C25H20F3N3O2S and a molecular weight of 483.52 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methylideneamino]-4-phenyl-3-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-imine.
| Compound Name | N-[(2,4-dimethoxyphenyl)methylideneamino]-4-phenyl-3-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 71830947 |
| Molecular Formula | C25H20F3N3O2S |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methylideneamino]-4-phenyl-3-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-imine |
| SMILES | COc1ccc(C=NN=c2scc(-c3ccccc3)n2-c2cccc(C(F)(F)F)c2)c(OC)c1 |
| InChI | InChI=1S/C25H20F3N3O2S/c1-32-21-12-11-18(23(14-21)33-2)15-29-30-24-31(20-10-6-9-19(13-20)25(26,27)28)22(16-34-24)17-7-4-3-5-8-17/h3-16H,1-2H3 |
| InChIKey | OHTJJCQHYDENHE-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 48.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|