C23H19N3O3S — CID 86575459
2-[(2Z)-2-[(E)-(3-methoxyphenyl)methylidenehydrazinylidene]-3-phenyl-1,3-thiazol-4-yl]benzene-1,4-diol (PubChem CID 86575459) has the molecular formula C23H19N3O3S and a molecular weight of 417.49 g/mol. Its IUPAC name is 2-[(2Z)-2-[(E)-(3-methoxyphenyl)methylidenehydrazinylidene]-3-phenyl-1,3-thiazol-4-yl]benzene-1,4-diol.
| Compound Name | 2-[(2Z)-2-[(E)-(3-methoxyphenyl)methylidenehydrazinylidene]-3-phenyl-1,3-thiazol-4-yl]benzene-1,4-diol |
|---|---|
| PubChem CID | 86575459 |
| Molecular Formula | C23H19N3O3S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 2-[(2Z)-2-[(E)-(3-methoxyphenyl)methylidenehydrazinylidene]-3-phenyl-1,3-thiazol-4-yl]benzene-1,4-diol |
| SMILES | COc1cccc(/C=N/N=c2\scc(-c3cc(O)ccc3O)n2-c2ccccc2)c1 |
| InChI | InChI=1S/C23H19N3O3S/c1-29-19-9-5-6-16(12-19)14-24-25-23-26(17-7-3-2-4-8-17)21(15-30-23)20-13-18(27)10-11-22(20)28/h2-15,27-28H,1H3/b24-14+,25-23- |
| InChIKey | LSUGRFSLSFLKNV-ROBZNLLGSA-N |
| XLogP | 4.56 |
| TPSA | 79.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|