C21H24FN5OS — CID 71833611
5-[(4-fluorophenyl)methylidene]-2-[4-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperazin-1-yl]-1,3-thiazol-4-one (PubChem CID 71833611) has the molecular formula C21H24FN5OS and a molecular weight of 413.52 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)methylidene]-2-[4-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperazin-1-yl]-1,3-thiazol-4-one.
| Compound Name | 5-[(4-fluorophenyl)methylidene]-2-[4-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperazin-1-yl]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 71833611 |
| Molecular Formula | C21H24FN5OS |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 5-[(4-fluorophenyl)methylidene]-2-[4-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperazin-1-yl]-1,3-thiazol-4-one |
| SMILES | Cc1nn(C)c(C)c1CN1CCN(C2=NC(=O)C(=Cc3ccc(F)cc3)S2)CC1 |
| InChI | InChI=1S/C21H24FN5OS/c1-14-18(15(2)25(3)24-14)13-26-8-10-27(11-9-26)21-23-20(28)19(29-21)12-16-4-6-17(22)7-5-16/h4-7,12H,8-11,13H2,1-3H3 |
| InChIKey | VGTQIAOJIWPDIM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 53.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|