C20H29N3O3 — CID 71846418
3-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-6,7,8-trimethoxy-1,2,4,5-tetrahydro-3-benzazepine (PubChem CID 71846418) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is 3-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-6,7,8-trimethoxy-1,2,4,5-tetrahydro-3-benzazepine.
| Compound Name | 3-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-6,7,8-trimethoxy-1,2,4,5-tetrahydro-3-benzazepine |
|---|---|
| PubChem CID | 71846418 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 3-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-6,7,8-trimethoxy-1,2,4,5-tetrahydro-3-benzazepine |
| SMILES | COc1cc2c(c(OC)c1OC)CCN(CCn1nc(C)cc1C)CC2 |
| InChI | InChI=1S/C20H29N3O3/c1-14-12-15(2)23(21-14)11-10-22-8-6-16-13-18(24-3)20(26-5)19(25-4)17(16)7-9-22/h12-13H,6-11H2,1-5H3 |
| InChIKey | MPEIAJQRXWXNCE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 48.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |