C14H16N4O4 — CID 71847066
3-[[2-(2-ethoxyphenoxy)acetyl]amino]-1H-pyrazole-5-carboxamide (PubChem CID 71847066) has the molecular formula C14H16N4O4 and a molecular weight of 304.31 g/mol. Its IUPAC name is 3-[[2-(2-ethoxyphenoxy)acetyl]amino]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-[[2-(2-ethoxyphenoxy)acetyl]amino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 71847066 |
| Molecular Formula | C14H16N4O4 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 3-[[2-(2-ethoxyphenoxy)acetyl]amino]-1H-pyrazole-5-carboxamide |
| SMILES | CCOc1ccccc1OCC(=O)Nc1cc(C(N)=O)[nH]n1 |
| InChI | InChI=1S/C14H16N4O4/c1-2-21-10-5-3-4-6-11(10)22-8-13(19)16-12-7-9(14(15)20)17-18-12/h3-7H,2,8H2,1H3,(H2,15,20)(H2,16,17,18,19) |
| InChIKey | SIXQUWZPKPTRHF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |