C20H31NO4 — CID 71848397
3-(3,4-diethoxyphenyl)-N-(5-hydroxy-4,4-dimethylpentyl)prop-2-enamide (PubChem CID 71848397) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is 3-(3,4-diethoxyphenyl)-N-(5-hydroxy-4,4-dimethylpentyl)prop-2-enamide.
| Compound Name | 3-(3,4-diethoxyphenyl)-N-(5-hydroxy-4,4-dimethylpentyl)prop-2-enamide |
|---|---|
| PubChem CID | 71848397 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | 3-(3,4-diethoxyphenyl)-N-(5-hydroxy-4,4-dimethylpentyl)prop-2-enamide |
| SMILES | CCOc1ccc(C=CC(=O)NCCCC(C)(C)CO)cc1OCC |
| InChI | InChI=1S/C20H31NO4/c1-5-24-17-10-8-16(14-18(17)25-6-2)9-11-19(23)21-13-7-12-20(3,4)15-22/h8-11,14,22H,5-7,12-13,15H2,1-4H3,(H,21,23) |
| InChIKey | MFZFLVQQNIFODT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|