C21H29N7O3 — CID 71849045
N'-[1-[2-(cyclopentylamino)-2-oxoethyl]pyrazol-4-yl]-N-[4-(pyridin-2-ylamino)butyl]oxamide (PubChem CID 71849045) has the molecular formula C21H29N7O3 and a molecular weight of 427.51 g/mol. Its IUPAC name is N'-[1-[2-(cyclopentylamino)-2-oxoethyl]pyrazol-4-yl]-N-[4-(pyridin-2-ylamino)butyl]oxamide.
| Compound Name | N'-[1-[2-(cyclopentylamino)-2-oxoethyl]pyrazol-4-yl]-N-[4-(pyridin-2-ylamino)butyl]oxamide |
|---|---|
| PubChem CID | 71849045 |
| Molecular Formula | C21H29N7O3 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | N'-[1-[2-(cyclopentylamino)-2-oxoethyl]pyrazol-4-yl]-N-[4-(pyridin-2-ylamino)butyl]oxamide |
| SMILES | O=C(Cn1cc(NC(=O)C(=O)NCCCCNc2ccccn2)cn1)NC1CCCC1 |
| InChI | InChI=1S/C21H29N7O3/c29-19(26-16-7-1-2-8-16)15-28-14-17(13-25-28)27-21(31)20(30)24-12-6-5-11-23-18-9-3-4-10-22-18/h3-4,9-10,13-14,16H,1-2,5-8,11-12,15H2,(H,22,23)(H,24,30)(H,26,29)(H,27,31) |
| InChIKey | NWNXSMAWUZIRRF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 130.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|