C21H34N6O3 — CID 96542802
N'-[1-[2-(cyclopentylamino)-2-oxoethyl]pyrazol-4-yl]-N-[(2R)-2-methyl-3-piperidin-1-ylpropyl]oxamide (PubChem CID 96542802) has the molecular formula C21H34N6O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is N'-[1-[2-(cyclopentylamino)-2-oxoethyl]pyrazol-4-yl]-N-[(2R)-2-methyl-3-piperidin-1-ylpropyl]oxamide.
| Compound Name | N'-[1-[2-(cyclopentylamino)-2-oxoethyl]pyrazol-4-yl]-N-[(2R)-2-methyl-3-piperidin-1-ylpropyl]oxamide |
|---|---|
| PubChem CID | 96542802 |
| Molecular Formula | C21H34N6O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | N'-[1-[2-(cyclopentylamino)-2-oxoethyl]pyrazol-4-yl]-N-[(2R)-2-methyl-3-piperidin-1-ylpropyl]oxamide |
| SMILES | C[C@H](CNC(=O)C(=O)Nc1cnn(CC(=O)NC2CCCC2)c1)CN1CCCCC1 |
| InChI | InChI=1S/C21H34N6O3/c1-16(13-26-9-5-2-6-10-26)11-22-20(29)21(30)25-18-12-23-27(14-18)15-19(28)24-17-7-3-4-8-17/h12,14,16-17H,2-11,13,15H2,1H3,(H,22,29)(H,24,28)(H,25,30)/t16-/m1/s1 |
| InChIKey | ZAIFUISYQOCVEV-MRXNPFEDSA-N |
| XLogP | 1.12 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|