C25H24N4O3 — CID 71849214
1-[2-(1,3-benzoxazol-2-yl)piperidin-1-yl]-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)ethane-1,2-dione (PubChem CID 71849214) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is 1-[2-(1,3-benzoxazol-2-yl)piperidin-1-yl]-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)ethane-1,2-dione.
| Compound Name | 1-[2-(1,3-benzoxazol-2-yl)piperidin-1-yl]-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 71849214 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 1-[2-(1,3-benzoxazol-2-yl)piperidin-1-yl]-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)ethane-1,2-dione |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(=O)C(=O)N1CCCCC1c1nc2ccccc2o1 |
| InChI | InChI=1S/C25H24N4O3/c1-16-22(17(2)29(27-16)18-10-4-3-5-11-18)23(30)25(31)28-15-9-8-13-20(28)24-26-19-12-6-7-14-21(19)32-24/h3-7,10-12,14,20H,8-9,13,15H2,1-2H3 |
| InChIKey | IXHGEIZFJPZCPW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 81.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|