C17H14BrF2NO3S — CID 71851609
3-(5-bromo-2-fluorophenyl)-N-[4-fluoro-2-(methylsulfonylmethyl)phenyl]prop-2-enamide (PubChem CID 71851609) has the molecular formula C17H14BrF2NO3S and a molecular weight of 430.27 g/mol. Its IUPAC name is 3-(5-bromo-2-fluorophenyl)-N-[4-fluoro-2-(methylsulfonylmethyl)phenyl]prop-2-enamide.
| Compound Name | 3-(5-bromo-2-fluorophenyl)-N-[4-fluoro-2-(methylsulfonylmethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 71851609 |
| Molecular Formula | C17H14BrF2NO3S |
| Molecular Weight | 430.27 g/mol |
| Exact Mass | 428.98 |
| IUPAC Name | 3-(5-bromo-2-fluorophenyl)-N-[4-fluoro-2-(methylsulfonylmethyl)phenyl]prop-2-enamide |
| SMILES | CS(=O)(=O)Cc1cc(F)ccc1NC(=O)C=Cc1cc(Br)ccc1F |
| InChI | InChI=1S/C17H14BrF2NO3S/c1-25(23,24)10-12-9-14(19)4-6-16(12)21-17(22)7-2-11-8-13(18)3-5-15(11)20/h2-9H,10H2,1H3,(H,21,22) |
| InChIKey | POEGRMCFKPHKSH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.27 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|