C16H22N4O2S — CID 71851940
2-methyl-N-[2-(1-methylpyrazol-4-yl)ethyl]-6-thiophen-3-ylmorpholine-4-carboxamide (PubChem CID 71851940) has the molecular formula C16H22N4O2S and a molecular weight of 334.45 g/mol. Its IUPAC name is 2-methyl-N-[2-(1-methylpyrazol-4-yl)ethyl]-6-thiophen-3-ylmorpholine-4-carboxamide.
| Compound Name | 2-methyl-N-[2-(1-methylpyrazol-4-yl)ethyl]-6-thiophen-3-ylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 71851940 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 2-methyl-N-[2-(1-methylpyrazol-4-yl)ethyl]-6-thiophen-3-ylmorpholine-4-carboxamide |
| SMILES | CC1CN(C(=O)NCCc2cnn(C)c2)CC(c2ccsc2)O1 |
| InChI | InChI=1S/C16H22N4O2S/c1-12-8-20(10-15(22-12)14-4-6-23-11-14)16(21)17-5-3-13-7-18-19(2)9-13/h4,6-7,9,11-12,15H,3,5,8,10H2,1-2H3,(H,17,21) |
| InChIKey | YEFCBNNPYIGJIS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |