C17H28N2O3S — CID 97093223
(2S,6S)-N-(5-hydroxy-4,4-dimethylpentyl)-2-methyl-6-thiophen-3-ylmorpholine-4-carboxamide (PubChem CID 97093223) has the molecular formula C17H28N2O3S and a molecular weight of 340.49 g/mol. Its IUPAC name is (2S,6S)-N-(5-hydroxy-4,4-dimethylpentyl)-2-methyl-6-thiophen-3-ylmorpholine-4-carboxamide.
| Compound Name | (2S,6S)-N-(5-hydroxy-4,4-dimethylpentyl)-2-methyl-6-thiophen-3-ylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 97093223 |
| Molecular Formula | C17H28N2O3S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | (2S,6S)-N-(5-hydroxy-4,4-dimethylpentyl)-2-methyl-6-thiophen-3-ylmorpholine-4-carboxamide |
| SMILES | C[C@H]1CN(C(=O)NCCCC(C)(C)CO)C[C@H](c2ccsc2)O1 |
| InChI | InChI=1S/C17H28N2O3S/c1-13-9-19(10-15(22-13)14-5-8-23-11-14)16(21)18-7-4-6-17(2,3)12-20/h5,8,11,13,15,20H,4,6-7,9-10,12H2,1-3H3,(H,18,21)/t13-,15+/m0/s1 |
| InChIKey | DBRKLWNPKINJIR-DZGCQCFKSA-N |
| XLogP | 3.02 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|