C16H22N4O2S — CID 97093234
(2R,6S)-2-methyl-N-(3-pyrazol-1-ylpropyl)-6-thiophen-3-ylmorpholine-4-carboxamide (PubChem CID 97093234) has the molecular formula C16H22N4O2S and a molecular weight of 334.45 g/mol. Its IUPAC name is (2R,6S)-2-methyl-N-(3-pyrazol-1-ylpropyl)-6-thiophen-3-ylmorpholine-4-carboxamide.
| Compound Name | (2R,6S)-2-methyl-N-(3-pyrazol-1-ylpropyl)-6-thiophen-3-ylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 97093234 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | (2R,6S)-2-methyl-N-(3-pyrazol-1-ylpropyl)-6-thiophen-3-ylmorpholine-4-carboxamide |
| SMILES | C[C@@H]1CN(C(=O)NCCCn2cccn2)C[C@H](c2ccsc2)O1 |
| InChI | InChI=1S/C16H22N4O2S/c1-13-10-19(11-15(22-13)14-4-9-23-12-14)16(21)17-5-2-7-20-8-3-6-18-20/h3-4,6,8-9,12-13,15H,2,5,7,10-11H2,1H3,(H,17,21)/t13-,15-/m1/s1 |
| InChIKey | AZKBGGGXQKPRJY-UKRRQHHQSA-N |
| XLogP | 2.51 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|