C20H19N5O3S — CID 71853041
1-benzyl-N-[4-[(5-methyl-1H-pyrazol-3-yl)oxy]phenyl]pyrazole-4-sulfonamide (PubChem CID 71853041) has the molecular formula C20H19N5O3S and a molecular weight of 409.47 g/mol. Its IUPAC name is 1-benzyl-N-[4-[(5-methyl-1H-pyrazol-3-yl)oxy]phenyl]pyrazole-4-sulfonamide.
| Compound Name | 1-benzyl-N-[4-[(5-methyl-1H-pyrazol-3-yl)oxy]phenyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 71853041 |
| Molecular Formula | C20H19N5O3S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 1-benzyl-N-[4-[(5-methyl-1H-pyrazol-3-yl)oxy]phenyl]pyrazole-4-sulfonamide |
| SMILES | Cc1cc(Oc2ccc(NS(=O)(=O)c3cnn(Cc4ccccc4)c3)cc2)n[nH]1 |
| InChI | InChI=1S/C20H19N5O3S/c1-15-11-20(23-22-15)28-18-9-7-17(8-10-18)24-29(26,27)19-12-21-25(14-19)13-16-5-3-2-4-6-16/h2-12,14,24H,13H2,1H3,(H,22,23) |
| InChIKey | ZYMGSZJWMWZHFN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |