C25H35N3O4 — CID 71854460
benzyl 3-(2-oxo-2-piperidin-1-ylethyl)-3-(piperidine-1-carbonyl)pyrrolidine-1-carboxylate (PubChem CID 71854460) has the molecular formula C25H35N3O4 and a molecular weight of 441.57 g/mol. Its IUPAC name is benzyl 3-(2-oxo-2-piperidin-1-ylethyl)-3-(piperidine-1-carbonyl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl 3-(2-oxo-2-piperidin-1-ylethyl)-3-(piperidine-1-carbonyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 71854460 |
| Molecular Formula | C25H35N3O4 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | benzyl 3-(2-oxo-2-piperidin-1-ylethyl)-3-(piperidine-1-carbonyl)pyrrolidine-1-carboxylate |
| SMILES | O=C(CC1(C(=O)N2CCCCC2)CCN(C(=O)OCc2ccccc2)C1)N1CCCCC1 |
| InChI | InChI=1S/C25H35N3O4/c29-22(26-13-6-2-7-14-26)18-25(23(30)27-15-8-3-9-16-27)12-17-28(20-25)24(31)32-19-21-10-4-1-5-11-21/h1,4-5,10-11H,2-3,6-9,12-20H2 |
| InChIKey | PGFGVVFBTBWPFX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |