C18H23N7O2 — CID 71857033
1-[1-(2-methoxyethyl)pyrazol-4-yl]-3-[2-(1-phenyltriazol-4-yl)propan-2-yl]urea (PubChem CID 71857033) has the molecular formula C18H23N7O2 and a molecular weight of 369.43 g/mol. Its IUPAC name is 1-[1-(2-methoxyethyl)pyrazol-4-yl]-3-[2-(1-phenyltriazol-4-yl)propan-2-yl]urea.
| Compound Name | 1-[1-(2-methoxyethyl)pyrazol-4-yl]-3-[2-(1-phenyltriazol-4-yl)propan-2-yl]urea |
|---|---|
| PubChem CID | 71857033 |
| Molecular Formula | C18H23N7O2 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 1-[1-(2-methoxyethyl)pyrazol-4-yl]-3-[2-(1-phenyltriazol-4-yl)propan-2-yl]urea |
| SMILES | COCCn1cc(NC(=O)NC(C)(C)c2cn(-c3ccccc3)nn2)cn1 |
| InChI | InChI=1S/C18H23N7O2/c1-18(2,16-13-25(23-22-16)15-7-5-4-6-8-15)21-17(26)20-14-11-19-24(12-14)9-10-27-3/h4-8,11-13H,9-10H2,1-3H3,(H2,20,21,26) |
| InChIKey | XIOWLBFQUMSIJA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 98.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |