C18H23F3N2O4S — CID 71858505
2-(1,1-dioxo-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl)-N-[[2-(trifluoromethoxy)phenyl]methyl]acetamide (PubChem CID 71858505) has the molecular formula C18H23F3N2O4S and a molecular weight of 420.45 g/mol. Its IUPAC name is 2-(1,1-dioxo-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl)-N-[[2-(trifluoromethoxy)phenyl]methyl]acetamide.
| Compound Name | 2-(1,1-dioxo-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl)-N-[[2-(trifluoromethoxy)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 71858505 |
| Molecular Formula | C18H23F3N2O4S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 2-(1,1-dioxo-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl)-N-[[2-(trifluoromethoxy)phenyl]methyl]acetamide |
| SMILES | O=C(CN1CCS(=O)(=O)C2CCCCC21)NCc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C18H23F3N2O4S/c19-18(20,21)27-15-7-3-1-5-13(15)11-22-17(24)12-23-9-10-28(25,26)16-8-4-2-6-14(16)23/h1,3,5,7,14,16H,2,4,6,8-12H2,(H,22,24) |
| InChIKey | NDBHHJBXZWLZJD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |