C13H15BrN2O2 — CID 71860164
N-(5-bromo-1-methyl-2-oxo-3-pyridinyl)cyclohex-3-ene-1-carboxamide (PubChem CID 71860164) has the molecular formula C13H15BrN2O2 and a molecular weight of 311.18 g/mol. Its IUPAC name is N-(5-bromo-1-methyl-2-oxo-3-pyridinyl)cyclohex-3-ene-1-carboxamide.
| Compound Name | N-(5-bromo-1-methyl-2-oxo-3-pyridinyl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 71860164 |
| Molecular Formula | C13H15BrN2O2 |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | N-(5-bromo-1-methyl-2-oxo-3-pyridinyl)cyclohex-3-ene-1-carboxamide |
| SMILES | Cn1cc(Br)cc(NC(=O)C2CC=CCC2)c1=O |
| InChI | InChI=1S/C13H15BrN2O2/c1-16-8-10(14)7-11(13(16)18)15-12(17)9-5-3-2-4-6-9/h2-3,7-9H,4-6H2,1H3,(H,15,17) |
| InChIKey | YSMMHXMBSPUBDH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|