C16H13NO3 — CID 71863244
1-[6-(1,2-oxazol-5-ylmethoxy)naphthalen-2-yl]ethanone (PubChem CID 71863244) has the molecular formula C16H13NO3 and a molecular weight of 267.28 g/mol. Its IUPAC name is 1-[6-(1,2-oxazol-5-ylmethoxy)naphthalen-2-yl]ethanone.
| Compound Name | 1-[6-(1,2-oxazol-5-ylmethoxy)naphthalen-2-yl]ethanone |
|---|---|
| PubChem CID | 71863244 |
| Molecular Formula | C16H13NO3 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 1-[6-(1,2-oxazol-5-ylmethoxy)naphthalen-2-yl]ethanone |
| SMILES | CC(=O)c1ccc2cc(OCc3ccno3)ccc2c1 |
| InChI | InChI=1S/C16H13NO3/c1-11(18)12-2-3-14-9-15(5-4-13(14)8-12)19-10-16-6-7-17-20-16/h2-9H,10H2,1H3 |
| InChIKey | SYUWMRFLGGGHLU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |