C16H22N2O — CID 71863695
N-(3,6-dihydro-2H-pyran-5-ylmethyl)-1-phenylpyrrolidin-3-amine (PubChem CID 71863695) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is N-(3,6-dihydro-2H-pyran-5-ylmethyl)-1-phenylpyrrolidin-3-amine.
| Compound Name | N-(3,6-dihydro-2H-pyran-5-ylmethyl)-1-phenylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 71863695 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | N-(3,6-dihydro-2H-pyran-5-ylmethyl)-1-phenylpyrrolidin-3-amine |
| SMILES | C1=C(CNC2CCN(c3ccccc3)C2)COCC1 |
| InChI | InChI=1S/C16H22N2O/c1-2-6-16(7-3-1)18-9-8-15(12-18)17-11-14-5-4-10-19-13-14/h1-3,5-7,15,17H,4,8-13H2 |
| InChIKey | MJTWAXGYWUUFGU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|