C13H11FN4O — CID 71867281
N-[(6-fluoro-1H-benzimidazol-2-yl)methyl]-1H-pyrrole-2-carboxamide (PubChem CID 71867281) has the molecular formula C13H11FN4O and a molecular weight of 258.26 g/mol. Its IUPAC name is N-[(6-fluoro-1H-benzimidazol-2-yl)methyl]-1H-pyrrole-2-carboxamide.
| Compound Name | N-[(6-fluoro-1H-benzimidazol-2-yl)methyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 71867281 |
| Molecular Formula | C13H11FN4O |
| Molecular Weight | 258.26 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | N-[(6-fluoro-1H-benzimidazol-2-yl)methyl]-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NCc1nc2ccc(F)cc2[nH]1)c1ccc[nH]1 |
| InChI | InChI=1S/C13H11FN4O/c14-8-3-4-9-11(6-8)18-12(17-9)7-16-13(19)10-2-1-5-15-10/h1-6,15H,7H2,(H,16,19)(H,17,18) |
| InChIKey | GSHUNTZCXGSBDI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |