C17H14FN5O — CID 90648663
N-[(6-fluoro-1H-benzimidazol-2-yl)methyl]-1-methylindazole-3-carboxamide (PubChem CID 90648663) has the molecular formula C17H14FN5O and a molecular weight of 323.33 g/mol. Its IUPAC name is N-[(6-fluoro-1H-benzimidazol-2-yl)methyl]-1-methylindazole-3-carboxamide.
| Compound Name | N-[(6-fluoro-1H-benzimidazol-2-yl)methyl]-1-methylindazole-3-carboxamide |
|---|---|
| PubChem CID | 90648663 |
| Molecular Formula | C17H14FN5O |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | N-[(6-fluoro-1H-benzimidazol-2-yl)methyl]-1-methylindazole-3-carboxamide |
| SMILES | Cn1nc(C(=O)NCc2nc3ccc(F)cc3[nH]2)c2ccccc21 |
| InChI | InChI=1S/C17H14FN5O/c1-23-14-5-3-2-4-11(14)16(22-23)17(24)19-9-15-20-12-7-6-10(18)8-13(12)21-15/h2-8H,9H2,1H3,(H,19,24)(H,20,21) |
| InChIKey | UXODWCAAQOOSRU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |