C15H24N2O2S2 — CID 71868510
1-[(4-methylsulfanyloxan-4-yl)methyl]-3-(1-thiophen-2-ylpropyl)urea (PubChem CID 71868510) has the molecular formula C15H24N2O2S2 and a molecular weight of 328.50 g/mol. Its IUPAC name is 1-[(4-methylsulfanyloxan-4-yl)methyl]-3-(1-thiophen-2-ylpropyl)urea.
| Compound Name | 1-[(4-methylsulfanyloxan-4-yl)methyl]-3-(1-thiophen-2-ylpropyl)urea |
|---|---|
| PubChem CID | 71868510 |
| Molecular Formula | C15H24N2O2S2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 1-[(4-methylsulfanyloxan-4-yl)methyl]-3-(1-thiophen-2-ylpropyl)urea |
| SMILES | CCC(NC(=O)NCC1(SC)CCOCC1)c1cccs1 |
| InChI | InChI=1S/C15H24N2O2S2/c1-3-12(13-5-4-10-21-13)17-14(18)16-11-15(20-2)6-8-19-9-7-15/h4-5,10,12H,3,6-9,11H2,1-2H3,(H2,16,17,18) |
| InChIKey | SRCJMIWVJAJPLO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |