About 1-(1-ethyl-3,5-dimethylpyrazol-4-yl)-3-[1-(2-methoxyethyl)pyrazol-3-yl]urea
1-(1-ethyl-3,5-dimethylpyrazol-4-yl)-3-[1-(2-methoxyethyl)pyrazol-3-yl]urea (PubChem CID 71870343) has the molecular formula C14H22N6O2
and a molecular weight of 306.37 g/mol. Its IUPAC name is 1-(1-ethyl-3,5-dimethylpyrazol-4-yl)-3-[1-(2-methoxyethyl)pyrazol-3-yl]urea.
Molecular Properties
| Compound Name | 1-(1-ethyl-3,5-dimethylpyrazol-4-yl)-3-[1-(2-methoxyethyl)pyrazol-3-yl]urea |
| PubChem CID | 71870343 |
| Molecular Formula | C14H22N6O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 1-(1-ethyl-3,5-dimethylpyrazol-4-yl)-3-[1-(2-methoxyethyl)pyrazol-3-yl]urea |
| SMILES | CCn1nc(C)c(NC(=O)Nc2ccn(CCOC)n2)c1C |
| InChI | InChI=1S/C14H22N6O2/c1-5-20-11(3)13(10(2)17-20)16-14(21)15-12-6-7-19(18-12)8-9-22-4/h6-7H,5,8-9H2,1-4H3,(H2,15,16,18,21) |
| InChIKey | FDYHSROGMYUBCR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 86.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(1-ethyl-3,5-dimethylpyrazol-4-yl)-3-[1-(2-methoxyethyl)pyrazol-3-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-ethyl-3,5-dimethylpyrazol-4-yl)-3-[1-(2-methoxyethyl)pyrazol-3-yl]urea?
The IUPAC name of 1-(1-ethyl-3,5-dimethylpyrazol-4-yl)-3-[1-(2-methoxyethyl)pyrazol-3-yl]urea (CID 71870343) is 1-(1-ethyl-3,5-dimethylpyrazol-4-yl)-3-[1-(2-methoxyethyl)pyrazol-3-yl]urea.
What is the SMILES notation for 1-(1-ethyl-3,5-dimethylpyrazol-4-yl)-3-[1-(2-methoxyethyl)pyrazol-3-yl]urea?
The canonical SMILES for 1-(1-ethyl-3,5-dimethylpyrazol-4-yl)-3-[1-(2-methoxyethyl)pyrazol-3-yl]urea is CCn1nc(C)c(NC(=O)Nc2ccn(CCOC)n2)c1C.
What is the InChIKey of 1-(1-ethyl-3,5-dimethylpyrazol-4-yl)-3-[1-(2-methoxyethyl)pyrazol-3-yl]urea?
The InChIKey is FDYHSROGMYUBCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N6O2/c1-5-20-11(3)13(10(2)17-20)16-14(21)15-12-6-7-19(18-12)8-9-22-4/h6-7H,5,8-9H2,1-4H3,(H2,15,16,18,21).
What are the key properties of 1-(1-ethyl-3,5-dimethylpyrazol-4-yl)-3-[1-(2-methoxyethyl)pyrazol-3-yl]urea?
1-(1-ethyl-3,5-dimethylpyrazol-4-yl)-3-[1-(2-methoxyethyl)pyrazol-3-yl]urea has a molecular weight of 306.37 g/mol, XLogP of 2.01, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-ethyl-3,5-dimethylpyrazol-4-yl)-3-[1-(2-methoxyethyl)pyrazol-3-yl]urea is sourced from PubChem (CID 71870343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).