C24H29NO4 — CID 71870514
(3,4-dimethoxy-5-prop-2-enylphenyl)-[2-(2-hydroxy-2-phenylethyl)pyrrolidin-1-yl]methanone (PubChem CID 71870514) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is (3,4-dimethoxy-5-prop-2-enylphenyl)-[2-(2-hydroxy-2-phenylethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (3,4-dimethoxy-5-prop-2-enylphenyl)-[2-(2-hydroxy-2-phenylethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 71870514 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | (3,4-dimethoxy-5-prop-2-enylphenyl)-[2-(2-hydroxy-2-phenylethyl)pyrrolidin-1-yl]methanone |
| SMILES | C=CCc1cc(C(=O)N2CCCC2CC(O)c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C24H29NO4/c1-4-9-18-14-19(15-22(28-2)23(18)29-3)24(27)25-13-8-12-20(25)16-21(26)17-10-6-5-7-11-17/h4-7,10-11,14-15,20-21,26H,1,8-9,12-13,16H2,2-3H3 |
| InChIKey | INIXDEZQJFJJMJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|