C16H22ClFN2O3 — CID 71874235
(2S)-N-[2-(2-chloro-4-fluorophenyl)ethyl]-2-[(2-methoxyacetyl)amino]-3-methylbutanamide (PubChem CID 71874235) has the molecular formula C16H22ClFN2O3 and a molecular weight of 344.81 g/mol. Its IUPAC name is (2S)-N-[2-(2-chloro-4-fluorophenyl)ethyl]-2-[(2-methoxyacetyl)amino]-3-methylbutanamide.
| Compound Name | (2S)-N-[2-(2-chloro-4-fluorophenyl)ethyl]-2-[(2-methoxyacetyl)amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 71874235 |
| Molecular Formula | C16H22ClFN2O3 |
| Molecular Weight | 344.81 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (2S)-N-[2-(2-chloro-4-fluorophenyl)ethyl]-2-[(2-methoxyacetyl)amino]-3-methylbutanamide |
| SMILES | COCC(=O)N[C@H](C(=O)NCCc1ccc(F)cc1Cl)C(C)C |
| InChI | InChI=1S/C16H22ClFN2O3/c1-10(2)15(20-14(21)9-23-3)16(22)19-7-6-11-4-5-12(18)8-13(11)17/h4-5,8,10,15H,6-7,9H2,1-3H3,(H,19,22)(H,20,21)/t15-/m0/s1 |
| InChIKey | DIJCSOMSRHRMOJ-HNNXBMFYSA-N |
| XLogP | 1.92 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.81 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |