C10H18N4O — CID 71878548
7-(2-ethoxyethyl)-3-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 71878548) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is 7-(2-ethoxyethyl)-3-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 7-(2-ethoxyethyl)-3-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 71878548 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 7-(2-ethoxyethyl)-3-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | CCOCCN1CCn2c(C)nnc2C1 |
| InChI | InChI=1S/C10H18N4O/c1-3-15-7-6-13-4-5-14-9(2)11-12-10(14)8-13/h3-8H2,1-2H3 |
| InChIKey | FHKDNNDYRGIFPY-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|