C16H11F3N2O4S — CID 71881359
N-(1-benzofuran-2-ylmethyl)-2-(trifluoromethylsulfonyl)pyridine-3-carboxamide (PubChem CID 71881359) has the molecular formula C16H11F3N2O4S and a molecular weight of 384.34 g/mol. Its IUPAC name is N-(1-benzofuran-2-ylmethyl)-2-(trifluoromethylsulfonyl)pyridine-3-carboxamide.
| Compound Name | N-(1-benzofuran-2-ylmethyl)-2-(trifluoromethylsulfonyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 71881359 |
| Molecular Formula | C16H11F3N2O4S |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | N-(1-benzofuran-2-ylmethyl)-2-(trifluoromethylsulfonyl)pyridine-3-carboxamide |
| SMILES | O=C(NCc1cc2ccccc2o1)c1cccnc1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H11F3N2O4S/c17-16(18,19)26(23,24)15-12(5-3-7-20-15)14(22)21-9-11-8-10-4-1-2-6-13(10)25-11/h1-8H,9H2,(H,21,22) |
| InChIKey | CFULMPNRZXJBFM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |