C20H25N3O2S — CID 71882814
N-cyclooctyl-N'-(2-cyclopropyl-1,3-benzothiazol-6-yl)oxamide (PubChem CID 71882814) has the molecular formula C20H25N3O2S and a molecular weight of 371.51 g/mol. Its IUPAC name is N-cyclooctyl-N'-(2-cyclopropyl-1,3-benzothiazol-6-yl)oxamide.
| Compound Name | N-cyclooctyl-N'-(2-cyclopropyl-1,3-benzothiazol-6-yl)oxamide |
|---|---|
| PubChem CID | 71882814 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | N-cyclooctyl-N'-(2-cyclopropyl-1,3-benzothiazol-6-yl)oxamide |
| SMILES | O=C(Nc1ccc2nc(C3CC3)sc2c1)C(=O)NC1CCCCCCC1 |
| InChI | InChI=1S/C20H25N3O2S/c24-18(21-14-6-4-2-1-3-5-7-14)19(25)22-15-10-11-16-17(12-15)26-20(23-16)13-8-9-13/h10-14H,1-9H2,(H,21,24)(H,22,25) |
| InChIKey | CDHBZEQPQZGXQC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|