C17H23N3O3S2 — CID 71843041
1-cyclohexyl-3-(2-propan-2-ylsulfonyl-1,3-benzothiazol-6-yl)urea (PubChem CID 71843041) has the molecular formula C17H23N3O3S2 and a molecular weight of 381.52 g/mol. Its IUPAC name is 1-cyclohexyl-3-(2-propan-2-ylsulfonyl-1,3-benzothiazol-6-yl)urea.
| Compound Name | 1-cyclohexyl-3-(2-propan-2-ylsulfonyl-1,3-benzothiazol-6-yl)urea |
|---|---|
| PubChem CID | 71843041 |
| Molecular Formula | C17H23N3O3S2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 1-cyclohexyl-3-(2-propan-2-ylsulfonyl-1,3-benzothiazol-6-yl)urea |
| SMILES | CC(C)S(=O)(=O)c1nc2ccc(NC(=O)NC3CCCCC3)cc2s1 |
| InChI | InChI=1S/C17H23N3O3S2/c1-11(2)25(22,23)17-20-14-9-8-13(10-15(14)24-17)19-16(21)18-12-6-4-3-5-7-12/h8-12H,3-7H2,1-2H3,(H2,18,19,21) |
| InChIKey | ZSOAYQAWERTIKD-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |