C18H19N3O3S2 — CID 83287784
1-(3-methylphenyl)-3-(2-propan-2-ylsulfonyl-1,3-benzothiazol-6-yl)urea (PubChem CID 83287784) has the molecular formula C18H19N3O3S2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 1-(3-methylphenyl)-3-(2-propan-2-ylsulfonyl-1,3-benzothiazol-6-yl)urea.
| Compound Name | 1-(3-methylphenyl)-3-(2-propan-2-ylsulfonyl-1,3-benzothiazol-6-yl)urea |
|---|---|
| PubChem CID | 83287784 |
| Molecular Formula | C18H19N3O3S2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 1-(3-methylphenyl)-3-(2-propan-2-ylsulfonyl-1,3-benzothiazol-6-yl)urea |
| SMILES | Cc1cccc(NC(=O)Nc2ccc3nc(S(=O)(=O)C(C)C)sc3c2)c1 |
| InChI | InChI=1S/C18H19N3O3S2/c1-11(2)26(23,24)18-21-15-8-7-14(10-16(15)25-18)20-17(22)19-13-6-4-5-12(3)9-13/h4-11H,1-3H3,(H2,19,20,22) |
| InChIKey | ODRXOLVEPUTACJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |