C18H23N3O3S — CID 71884484
N-(1-cyanocyclobutyl)-3-(cyclopentylsulfamoyl)-N-methylbenzamide (PubChem CID 71884484) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is N-(1-cyanocyclobutyl)-3-(cyclopentylsulfamoyl)-N-methylbenzamide.
| Compound Name | N-(1-cyanocyclobutyl)-3-(cyclopentylsulfamoyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 71884484 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N-(1-cyanocyclobutyl)-3-(cyclopentylsulfamoyl)-N-methylbenzamide |
| SMILES | CN(C(=O)c1cccc(S(=O)(=O)NC2CCCC2)c1)C1(C#N)CCC1 |
| InChI | InChI=1S/C18H23N3O3S/c1-21(18(13-19)10-5-11-18)17(22)14-6-4-9-16(12-14)25(23,24)20-15-7-2-3-8-15/h4,6,9,12,15,20H,2-3,5,7-8,10-11H2,1H3 |
| InChIKey | CRGGSOQDBCACJD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |