C19H23N3O4 — CID 71884581
1-(furan-2-ylmethyl)-1-[(2-hydroxyphenyl)methyl]-3-(2-oxoazepan-3-yl)urea (PubChem CID 71884581) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-1-[(2-hydroxyphenyl)methyl]-3-(2-oxoazepan-3-yl)urea.
| Compound Name | 1-(furan-2-ylmethyl)-1-[(2-hydroxyphenyl)methyl]-3-(2-oxoazepan-3-yl)urea |
|---|---|
| PubChem CID | 71884581 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 1-(furan-2-ylmethyl)-1-[(2-hydroxyphenyl)methyl]-3-(2-oxoazepan-3-yl)urea |
| SMILES | O=C1NCCCCC1NC(=O)N(Cc1ccco1)Cc1ccccc1O |
| InChI | InChI=1S/C19H23N3O4/c23-17-9-2-1-6-14(17)12-22(13-15-7-5-11-26-15)19(25)21-16-8-3-4-10-20-18(16)24/h1-2,5-7,9,11,16,23H,3-4,8,10,12-13H2,(H,20,24)(H,21,25) |
| InChIKey | JOBMYDKBCKOWPV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|