C19H12ClFN4O — CID 71886000
1-(6-chloro-1H-indol-3-yl)-3-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]prop-2-en-1-one (PubChem CID 71886000) has the molecular formula C19H12ClFN4O and a molecular weight of 366.78 g/mol. Its IUPAC name is 1-(6-chloro-1H-indol-3-yl)-3-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]prop-2-en-1-one.
| Compound Name | 1-(6-chloro-1H-indol-3-yl)-3-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 71886000 |
| Molecular Formula | C19H12ClFN4O |
| Molecular Weight | 366.78 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 1-(6-chloro-1H-indol-3-yl)-3-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(-n2cncn2)c(F)c1)c1c[nH]c2cc(Cl)ccc12 |
| InChI | InChI=1S/C19H12ClFN4O/c20-13-3-4-14-15(9-23-17(14)8-13)19(26)6-2-12-1-5-18(16(21)7-12)25-11-22-10-24-25/h1-11,23H |
| InChIKey | LDVDTYCDOGUWOL-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.78 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|