C21H19N5O — CID 71886124
N-[3-(4-methyl-1,2,4-triazol-3-yl)phenyl]-1-prop-2-enylindole-3-carboxamide (PubChem CID 71886124) has the molecular formula C21H19N5O and a molecular weight of 357.42 g/mol. Its IUPAC name is N-[3-(4-methyl-1,2,4-triazol-3-yl)phenyl]-1-prop-2-enylindole-3-carboxamide.
| Compound Name | N-[3-(4-methyl-1,2,4-triazol-3-yl)phenyl]-1-prop-2-enylindole-3-carboxamide |
|---|---|
| PubChem CID | 71886124 |
| Molecular Formula | C21H19N5O |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | N-[3-(4-methyl-1,2,4-triazol-3-yl)phenyl]-1-prop-2-enylindole-3-carboxamide |
| SMILES | C=CCn1cc(C(=O)Nc2cccc(-c3nncn3C)c2)c2ccccc21 |
| InChI | InChI=1S/C21H19N5O/c1-3-11-26-13-18(17-9-4-5-10-19(17)26)21(27)23-16-8-6-7-15(12-16)20-24-22-14-25(20)2/h3-10,12-14H,1,11H2,2H3,(H,23,27) |
| InChIKey | DYNUXDVQKAIDPQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|