C14H14N2O4S2 — CID 71893535
N-(3-acetylphenyl)sulfonyl-2,4-dimethyl-1,3-thiazole-5-carboxamide (PubChem CID 71893535) has the molecular formula C14H14N2O4S2 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-(3-acetylphenyl)sulfonyl-2,4-dimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-(3-acetylphenyl)sulfonyl-2,4-dimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 71893535 |
| Molecular Formula | C14H14N2O4S2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | N-(3-acetylphenyl)sulfonyl-2,4-dimethyl-1,3-thiazole-5-carboxamide |
| SMILES | CC(=O)c1cccc(S(=O)(=O)NC(=O)c2sc(C)nc2C)c1 |
| InChI | InChI=1S/C14H14N2O4S2/c1-8-13(21-10(3)15-8)14(18)16-22(19,20)12-6-4-5-11(7-12)9(2)17/h4-7H,1-3H3,(H,16,18) |
| InChIKey | XMAUXEPKFVXVHF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |